Compound Q&A

What precautions should be taken when handling Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6)?

Answer

Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate
When handling Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or under a fume hood to minimize inhalation risks. Spills should be handled with caution using an appropriate absorbent material and the area should be cleaned with water and detergent. Refer to the Safety Data Sheet (SDS) for detailed instructions and emergency procedures.

About

CAS No 97-41-6
English Name Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate
Molecular Formula C12H20O2
Molecular Weight 196.29 g/mol
SMILES CCOC(=O)C1C(C=C(C)C)C1(C)C
InChIKey VIMXTGUGWLAOFZ-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6)?

Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6) is a colorless l...

Compound Q&A

How is Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6) typically synthesized?

Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6) can be synthesiz...

Compound Q&A

What industries use Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6)?

Ethyl 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)cyclopropanecarboxylate (CAS: 97-41-6) is primarily use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...