Compound Q&A

What industries use 1,3,5-Trifluoro-2-nitrobenzene (CAS: 315-14-0)?

Answer

1,3,5-Trifluoro-2-nitrobenzene
1,3,5-Trifluoro-2-nitrobenzene is primarily used in the pharmaceutical industry for the synthesis of drugs, particularly those requiring specific functional groups for modification. It also has applications in the polymer and semiconductor industries, where its unique chemical properties are utilized.

About

CAS No 315-14-0
English Name 1,3,5-Trifluoro-2-nitrobenzene
Molecular Formula C6H2F3NO2
Molecular Weight 177.08 g/mol
SMILES C1=C(C=C(C(=C1F)[N+](=O)[O-])F)F
InChIKey PWRFDGYYJWQIAB-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Trifluoro-2-nitrobenzene (CAS: 315-14-0)?

1,3,5-Trifluoro-2-nitrobenzene (CAS: 315-14-0) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 1,3,5-Trifluoro-2-nitrobenzene (CAS: 315-14-0) typically synthesized?

1,3,5-Trifluoro-2-nitrobenzene can be synthesized via the nitration of 1,3,5-trifluorobenzene, usual...

Compound Q&A

What precautions should be taken when handling 1,3,5-Trifluoro-2-nitrobenzene (CAS: 315-14-0)?

When handling 1,3,5-Trifluoro-2-nitrobenzene, always wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...