Compound Q&A

What are the physical and chemical properties of 2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2)?

Answer

2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (1:1)
2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2) is a crystalline compound with a molecular weight of approximately 528.12 g/mol. It is slightly soluble in water and has a high reactivity towards metal ions. Its physical properties include a melting point of 265-268°C. It is a chelating agent with a high affinity for metal ions, making it useful in various chemical and industrial applications.

About

CAS No 482-54-2
English Name 2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (1:1)
Molecular Formula C14H24N2O9
Molecular Weight 346.34 g/mol
SMILES OC(=O)CN(CC(O)=O)C1CCCCC1N(CC(O)=O)CC(O)=O
InChIKey VASZYFIKPKYGNC-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2) typically synthesized?

2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2) is typically sy...

Compound Q&A

What industries use 2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2)?

2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2) is widely used ...

Compound Q&A

What precautions should be taken when handling 2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2)?

When handling 2,2',2'',2'''-(1,2-Cyclohexanediyldinitrilo)tetraacetic acid hydrate (CAS: 482-54-2), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...