Compound Q&A

What are the physical and chemical properties of Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate (CAS: 129541-41-9)?

Answer

Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate
Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate is a crystalline compound with a molecular weight of approximately 674.2 g/mol. It has a high solubility in water and exhibits moderate reactivity in organic solvents. This compound is known for its stability under normal storage conditions and requires careful handling during synthesis and use due to its chemical reactivity.

About

English Name Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate
Molecular Formula C14H12BrClNNaO7
Molecular Weight 444.59 g/mol
SMILES C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)[O-])O)O)O)Cl)Br.[Na+]
InChIKey IBLSVGDGSKUDCT-CYRSAHDMSA-M
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate (CAS: 129541-41-9) typically synthesized?

Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate is synthesized through a multi-st...

Compound Q&A

What industries use Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate (CAS: 129541-41-9)?

Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate is utilized in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate (CAS: 129541-41-9)?

When handling Sodium 5-bromo-4-chloro-1H-indol-3-yl beta-D-glucopyranosiduronate, it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...