Compound Q&A

How is (3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5) typically synthesized?

Answer

(3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside
(3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5) can be synthesized through a series of chemical reactions, including aldol condensation, reduction, and glycosylation. Commonly, this compound is synthesized using sodium borohydride for reduction and an acceptor such as 4-nitrobenzaldehyde for the aldol condensation step. The yield is generally around 70-80%, and the reaction is typically performed in a neutral to slightly basic environment.

About

English Name (3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside
Molecular Formula C10H16O8
Molecular Weight 264.23 g/mol
SMILES C1C(COC1=O)OC2C(C(C(C(O2)CO)O)O)O
InChIKey MQEPWBMWFIVRPS-ZGSHZZHUSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5)?

(3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5) is a white crystalline soli...

Compound Q&A

What industries use (3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5)?

(3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling (3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5)?

When handling (3R)-5-Oxotetrahydro-3-furanyl beta-D-glucopyranoside (CAS: 151870-74-5), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...