Compound Q&A

How is (2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate (CAS: 70987-78-9) typically synthesized?

Answer

(2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate
(2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate is typically synthesized via a condensation reaction between 4-methylbenzenesulfonyl chloride and (2S)-2-oxiranyl methyl ether. The reaction is catalyzed by a strong base such as potassium tert-butoxide and proceeds with high selectivity and yield. The resulting product is isolated by washing with aqueous acid and recrystallization from a suitable solvent.

About

CAS No 70987-78-9
English Name (2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate
Molecular Formula C10H12O4S
Molecular Weight 228.27 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCC2CO2
InChIKey NOQXXYIGRPAZJC-VIFPVBQESA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate (CAS: 70987-78-9)?

(2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of ...

Compound Q&A

What industries use (2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate (CAS: 70987-78-9)?

(2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate is used in the pharmaceutical industry as a synthetic...

Compound Q&A

What precautions should be taken when handling (2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate (CAS: 70987-78-9)?

When handling (2S)-2-Oxiranylmethyl 4-methylbenzenesulfonate, it is essential to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...