Compound Q&A

How should [2-Chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 254993-59-4) be stored?

Answer

[2-Chloro-4-(trifluoromethyl)phenyl]boronic acid
[2-Chloro-4-(trifluoromethyl)phenyl]boronic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly closed container to prevent exposure to air and moisture. Proper storage conditions help maintain the stability and reactivity of the compound, ensuring it remains effective for its intended use in chemical reactions and synthesis processes.

About

English Name [2-Chloro-4-(trifluoromethyl)phenyl]boronic acid
Molecular Formula C7H5BClF3O2
Molecular Weight 224.37 g/mol
SMILES B(C1=C(C=C(C=C1)C(F)(F)F)Cl)(O)O
InChIKey JKSUCAFAUNSPLO-UHFFFAOYSA-N
Last Updated: 2025-09-18 13:36

Related Q&A

Compound Q&A

What is [2-Chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 254993-59-4)?

[2-Chloro-4-(trifluoromethyl)phenyl]boronic acid is an organic compound with the CAS number 254993-5...

Compound Q&A

What are the main uses of [2-Chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 254993-59-4)?

[2-Chloro-4-(trifluoromethyl)phenyl]boronic acid is primarily used in organic synthesis, particularl...

Compound Q&A

Is [2-Chloro-4-(trifluoromethyl)phenyl]boronic acid (CAS: 254993-59-4) safe?

[2-Chloro-4-(trifluoromethyl)phenyl]boronic acid is generally considered safe when handled under nor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...