Compound Q&A

What are the main uses of 4-Hydroxy-3-nitrobenzoic acid (CAS: 616-82-0)?

Answer

4-Hydroxy-3-nitrobenzoic acid
4-Hydroxy-3-nitrobenzoic acid is primarily used as a starting material in the production of dyes and pharmaceuticals. It is also utilized in the synthesis of other organic compounds. Additionally, it has applications in research and development for its unique chemical properties.

About

CAS No 616-82-0
English Name 4-Hydroxy-3-nitrobenzoic acid
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])O
InChIKey QRYSWXFQLFLJTC-UHFFFAOYSA-N
Last Updated: 2025-09-18 13:36

Related Q&A

Compound Q&A

What is 4-Hydroxy-3-nitrobenzoic acid (CAS: 616-82-0)?

4-Hydroxy-3-nitrobenzoic acid is a chemical compound with the molecular formula C7H5NO4. It is a whi...

Compound Q&A

Is 4-Hydroxy-3-nitrobenzoic acid (CAS: 616-82-0) safe?

4-Hydroxy-3-nitrobenzoic acid is generally considered safe when handled with appropriate precautions...

Compound Q&A

How should 4-Hydroxy-3-nitrobenzoic acid (CAS: 616-82-0) be stored?

4-Hydroxy-3-nitrobenzoic acid should be stored in a cool, dry place away from direct sunlight and he...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...