Compound Q&A

How should 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid (CAS: 32432-55-6) be stored?

Answer

3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid
3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent contamination and ensure its stability. Proper ventilation should be maintained during storage to minimize the risk of reaction with other substances.

About

CAS No 32432-55-6
English Name 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid
Molecular Formula C9H14N2O3S
Molecular Weight 230.29 g/mol
SMILES CC1=C(C(=C(C(=C1N)C)S(=O)(=O)O)C)N
InChIKey PKKGGWLTUCMSSD-UHFFFAOYSA-N
Last Updated: 2025-09-18 13:36

Related Q&A

Compound Q&A

What is 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid (CAS: 32432-55-6)?

3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid is a chemical compound with the CAS number 32432-55-...

Compound Q&A

What are the main uses of 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid (CAS: 32432-55-6)?

3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid is primarily used in the pharmaceutical industry as ...

Compound Q&A

Is 3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid (CAS: 32432-55-6) safe?

3,5-Diamino-2,4,6-trimethylbenzenesulfonic acid is generally considered safe when handled with appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...