Compound Q&A

How should 2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine (CAS: 13276-52-3) be stored?

Answer

2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine
2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine should be stored in a cool, dry place away from direct sunlight and heat sources. Keep the container tightly sealed to prevent moisture and air exposure. Store it at room temperature, preferably between 15-25°C. Use a dark-colored container to minimize light exposure, which can affect the compound's stability. Keep it out of reach of children and unauthorized personnel, and store it in a secure location to prevent accidental exposure or theft.

About

CAS No 13276-52-3
English Name 2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine
Molecular Formula C10H10Cl2N4O4
Molecular Weight 321.12 g/mol
SMILES C1=NC2=C(N1C3C(C(C(O3)CO)O)O)N=C(N=C2Cl)Cl
InChIKey HJXWZGVMHDPCRS-UUOKFMHZSA-N
Last Updated: 2025-09-18 13:36

Related Q&A

Compound Q&A

What is 2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine (CAS: 13276-52-3)?

2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine is a purine derivative with the CAS number 13276-52-...

Compound Q&A

What are the main uses of 2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine (CAS: 13276-52-3)?

2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine is primarily used in the development of antiviral an...

Compound Q&A

Is 2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine (CAS: 13276-52-3) safe?

2,6-Dichloro-9-(beta-D-ribofuranosyl)-9H-purine is generally safe when used under controlled laborat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...