Compound Q&A

Are there alternatives to 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5) in synthesis?

Answer

3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid
While 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5) is a specific compound, there are alternative reagents and compounds that can be used in similar synthesis processes. For example, other sulfonic acids or related aromatic compounds might serve as effective alternatives depending on the specific reaction conditions and desired product. Always consider the availability, cost, and reactivity of these alternatives.

About

CAS No 96-93-5
English Name 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid
Molecular Formula C6H6N2O6S
Molecular Weight 234.19 g/mol
SMILES C1=C(C=C(C(=C1N)O)[N+](=O)[O-])S(=O)(=O)O
InChIKey RHPXYZMDLOJTFF-UHFFFAOYSA-N
Last Updated: 2025-09-17 14:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5)?

3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5) is regulated under the Globally Harmoni...

Compound Q&A

What is the market or research trend for 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5)?

The market for 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5) is primarily driven by i...

Compound Q&A

How should waste containing 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5) be handled?

Waste containing 3-Amino-4-hydroxy-5-nitrobenzenesulfonic acid (CAS: 96-93-5) should be collected in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...