Compound Q&A

Are there alternatives to 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol in synthesis?

Answer

5-Amino-2,4-bis(2-methyl-2-propanyl)phenol
While 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol is a specific compound, there are alternative reagents that can be used depending on the desired reaction. For example, other phenolic compounds or amino compounds may serve similar roles in certain synthetic routes. However, the choice of alternative depends on the specific application and reaction conditions.

About

English Name 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol
Molecular Formula C14H23NO
Molecular Weight 221.34 g/mol
SMILES Nc1cc(O)c(cc1C(C)(C)C)C(C)(C)C
InChIKey BKSDHPHOWDUJNB-UHFFFAOYSA-N
Last Updated: 2025-09-17 14:48

Related Q&A

Compound Q&A

What regulatory guidelines apply to 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol (CAS: 873055-58-4)?

5-Amino-2,4-bis(2-methyl-2-propanyl)phenol (CAS: 873055-58-4) falls under the classification of a ch...

Compound Q&A

What is the market or research trend for 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol?

The market for 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol is currently growing as it finds applicati...

Compound Q&A

How should waste containing 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol be handled?

Waste containing 5-Amino-2,4-bis(2-methyl-2-propanyl)phenol should be collected in appropriate conta...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...