Compound Q&A

How is 2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-0) typically synthesized?

Answer

2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (1:1)
2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-0) is typically synthesized by the condensation of 2,3-dihydro-1,4-benzodioxin-2-one with 1-piperazinecarboxylic acid. The reaction is usually catalyzed by a suitable base, and the product is obtained with good yield. The synthesis is carried out under mild conditions, and the product is isolated by recrystallization from an appropriate solvent.

About

CAS No 70918-74-0
English Name 2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (1:1)
Molecular Formula C13H17ClN2O3
Molecular Weight 284.74 g/mol
SMILES C1CN(CCN1)C(=O)C2COC3=CC=CC=C3O2.Cl
InChIKey TUKBWYXLYINULI-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-0)?

2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-0) is a crysta...

Compound Q&A

What industries use 2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-0)?

2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-0) is primaril...

Compound Q&A

What precautions should be taken when handling 2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-0)?

When handling 2,3-Dihydro-1,4-benzodioxin-2-yl(1-piperazinyl)methanone hydrochloride (CAS: 70918-74-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...