Compound Q&A

How is Maltopentose (CAS: 34620-76-3) typically synthesized?

Answer

Maltopentose
Maltopentose (CAS: 34620-76-3) can be synthesized through the hydrolysis of maltotriose or by the condensation of glucose with a reducing agent. This process often involves the use of acid or base catalysis, with high yields and good selectivity. The specific conditions, such as temperature and pH, can vary depending on the chosen method and desired purity of the product.

About

CAS No 34620-76-3
English Name Maltopentose
Molecular Formula C27H48O26
Molecular Weight 788.66 g/mol
SMILES C(C1C(C(C(C(O1)OC2C(C(C(OC2O)OC3C(OC(C(C3O)O)OC(C(C(CO)O)O)OCO)CO)O)O)O)O)OC4C(C(C(C(O4)O)O)O)O)O
InChIKey JAEVVUVBPPQABG-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Maltopentose (CAS: 34620-76-3)?

Maltopentose (CAS: 34620-76-3) is a crystalline compound with a molecular weight of approximately 16...

Compound Q&A

What industries use Maltopentose (CAS: 34620-76-3)?

Maltopentose (CAS: 34620-76-3) is utilized in the pharmaceutical industry for the production of cert...

Compound Q&A

What precautions should be taken when handling Maltopentose (CAS: 34620-76-3)?

When handling Maltopentose (CAS: 34620-76-3), it is important to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...