Compound Q&A

How is Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4) typically synthesized?

Answer

Methyl 5-acetyl-2-hydroxybenzoate
Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4) is commonly synthesized through the esterification of acetic anhydride with 2-hydroxybenzoic acid. The reaction is typically carried out under mild conditions, with the use of a catalyst such as sulfuric acid or p-toluenesulfonic acid to enhance the reaction rate and selectivity.

About

CAS No 16475-90-4
English Name Methyl 5-acetyl-2-hydroxybenzoate
Molecular Formula C10H10O4
Molecular Weight 194.19 g/mol
SMILES CC(=O)C1=CC(=C(C=C1)O)C(=O)OC
InChIKey XLSMGNNWSRNTIQ-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4)?

Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4)?

Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4) finds applications in various industries. It is ...

Compound Q&A

What precautions should be taken when handling Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4)?

When handling Methyl 5-acetyl-2-hydroxybenzoate (CAS: 16475-90-4), proper personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...