Compound Q&A

What are the physical and chemical properties of 2-(3,4-Dihydroxyphenyl)ethyl 6-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-beta-D-glucopyranoside (CAS: 105471-98-5)?

Answer

2-(3,4-Dihydroxyphenyl)ethyl 6-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-beta-D-glucopyranoside
This compound exhibits a crystalline form with a molecular weight of approximately 516.47 g/mol. It has limited water solubility and moderate solubility in organic solvents. Chemically, it is reactive towards nucleophiles and can undergo hydrolysis and condensation reactions under certain conditions.

About

English Name 2-(3,4-Dihydroxyphenyl)ethyl 6-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-beta-D-glucopyranoside
Molecular Formula C23H26O11
Molecular Weight 478.45 g/mol
SMILES O=C(OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H](OCCC2=CC=C(O)C(O)=C2)O1)/C=C/C3=CC=C(O)C(O)=C3
InChIKey LFKQVVDFNHDYNK-FOXCETOMSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is 2-(3,4-Dihydroxyphenyl)ethyl 6-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-beta-D-glucopyranoside (CAS: 105471-98-5) typically synthesized?

It is commonly synthesized via a multi-step process involving the protection of the hydroxyl groups,...

Compound Q&A

What industries use 2-(3,4-Dihydroxyphenyl)ethyl 6-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-beta-D-glucopyranoside (CAS: 105471-98-5)?

This compound is primarily used in the pharmaceutical industry for its potential in drug development...

Compound Q&A

What precautions should be taken when handling 2-(3,4-Dihydroxyphenyl)ethyl 6-O-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoyl]-beta-D-glucopyranoside (CAS: 105471-98-5)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. H...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...