Compound Q&A

What are the physical and chemical properties of (2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8)?

Answer

(2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol
The compound (2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8) is a crystalline solid with a molecular weight of approximately 492.7 g/mol. It has a low water solubility, making it suitable for use in organic solvents. The compound is generally stable under normal conditions but may react with strong oxidizers. It is not reactive towards common organic reagents under normal conditions. It is commonly used in specialized applications requiring specific optical and chromophoric properties.

About

CAS No 148-03-8
English Name (2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol
Molecular Formula C28H48O2
Molecular Weight 416.69 g/mol
SMILES CC1=CC(=C(C2=C1OC(CC2)(C)CCCC(C)CCCC(C)CCCC(C)C)C)O
InChIKey WGVKWNUPNGFDFJ-DQCZWYHMSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is (2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8) typically synthesized?

(2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8) is typically s...

Compound Q&A

What industries use (2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8)?

(2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8) is utilized in...

Compound Q&A

What precautions should be taken when handling (2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8)?

When handling (2R)-2,5,8-Trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-6-chromanol (CAS: 148-03-8),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...