Compound Q&A

How is Methyl 2-bromo-5-chlorobenzoate (CAS: 27007-53-0) typically synthesized?

Answer

Methyl 2-bromo-5-chlorobenzoate
Methyl 2-bromo-5-chlorobenzoate is typically synthesized from 2-chlorobenzoic acid and methyl bromide in the presence of a base such as potassium carbonate. The reaction involves the substitution of the hydroxyl group of the benzoic acid with a bromomethyl group, followed by the displacement of the chlorine atom by bromine. This process yields a high yield of the desired product with excellent selectivity.

About

CAS No 27007-53-0
English Name Methyl 2-bromo-5-chlorobenzoate
Molecular Formula C8H6BrClO2
Molecular Weight 249.49 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)Cl)Br
InChIKey BIECSXCXIXHDBC-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 2-bromo-5-chlorobenzoate (CAS: 27007-53-0)?

Methyl 2-bromo-5-chlorobenzoate is a white crystalline solid with a molecular weight of approximatel...

Compound Q&A

What industries use Methyl 2-bromo-5-chlorobenzoate (CAS: 27007-53-0)?

Methyl 2-bromo-5-chlorobenzoate is used in the pharmaceutical industry for the synthesis of certain ...

Compound Q&A

What precautions should be taken when handling Methyl 2-bromo-5-chlorobenzoate (CAS: 27007-53-0)?

When handling Methyl 2-bromo-5-chlorobenzoate, it is important to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...