Compound Q&A

How is 4,6-Dichloropyrimidine-5-carboxylic acid (CAS: 87600-98-4) typically synthesized?

Answer

4,6-Dichloropyrimidine-5-carboxylic acid
4,6-Dichloropyrimidine-5-carboxylic acid can be synthesized through the condensation of 4,6-dichloropyrimidine with acetic anhydride. The reaction is catalyzed by phosphoric acid and typically yields a pure product with good selectivity and high yield.

About

CAS No 87600-98-4
English Name 4,6-Dichloropyrimidine-5-carboxylic acid
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES C1=NC(=C(C(=N1)Cl)C(=O)O)Cl
InChIKey KGBLYFGHJNGQBK-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,6-Dichloropyrimidine-5-carboxylic acid (CAS: 87600-98-4)?

4,6-Dichloropyrimidine-5-carboxylic acid is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 4,6-Dichloropyrimidine-5-carboxylic acid (CAS: 87600-98-4)?

4,6-Dichloropyrimidine-5-carboxylic acid is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 4,6-Dichloropyrimidine-5-carboxylic acid (CAS: 87600-98-4)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...