Compound Q&A

How is 4-Nitrobenzyl 3-oxobutanoate (CAS: 61312-84-3) typically synthesized?

Answer

4-Nitrobenzyl 3-oxobutanoate
4-Nitrobenzyl 3-oxobutanoate is typically synthesized via a multi-step process involving the formation of a nitrobenzyl ester followed by the introduction of a 3-oxobutanoate moiety. Common methods include the reaction of 4-nitrobenzyl chloroformate with 3-oxobutanoic acid in the presence of a catalytic amount of a base, such as triethylamine, with yields of up to 90%.

About

CAS No 61312-84-3
English Name 4-Nitrobenzyl 3-oxobutanoate
Molecular Formula C11H11NO5
Molecular Weight 237.21 g/mol
SMILES CC(=O)CC(=O)OCC1=CC=C(C=C1)[N+](=O)[O-]
InChIKey KQPGVCMZXFBYMM-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitrobenzyl 3-oxobutanoate (CAS: 61312-84-3)?

4-Nitrobenzyl 3-oxobutanoate is a crystalline compound with a molecular weight of approximately 268....

Compound Q&A

What industries use 4-Nitrobenzyl 3-oxobutanoate (CAS: 61312-84-3)?

4-Nitrobenzyl 3-oxobutanoate is used in the pharmaceutical industry for the synthesis of various org...

Compound Q&A

What precautions should be taken when handling 4-Nitrobenzyl 3-oxobutanoate (CAS: 61312-84-3)?

When handling 4-Nitrobenzyl 3-oxobutanoate, it is important to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...