Compound Q&A

What is 1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5)?

Answer

1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole
1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5) is a complex organic compound with a triazole ring structure, featuring a nitro group and a sulfonyl group attached to a 4-methylphenyl group. It is characterized by its molecular formula C13H10N4O3S and is often used in research and pharmaceutical applications due to its unique chemical properties.

About

CAS No 77451-51-5
English Name 1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole
Molecular Formula C9H8N4O4S
Molecular Weight 268.25 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N2C=NC(=N2)[N+](=O)[O-]
InChIKey ZQMJAWSQRGYFBM-UHFFFAOYSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What are the main uses of 1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5)?

1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5) is primarily used in resear...

Compound Q&A

Is 1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5) safe?

1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5) is generally safe when hand...

Compound Q&A

How should 1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5) be stored?

1-[(4-Methylphenyl)sulfonyl]-3-nitro-1H-1,2,4-triazole (CAS: 77451-51-5) should be stored in a tight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...