Compound Q&A

What is 1,2-Diphenylethylenediamine (CAS: 16635-95-3)?

Answer

1,2-Diphenylethylenediamine
1,2-Diphenylethylenediamine (CAS: 16635-95-3) is an organic compound with the molecular formula C12H14N2. It is a diamine with two phenyl groups attached to an ethylene moiety. This compound is used in pharmaceuticals and as a chemical intermediate in the synthesis of other compounds.

About

CAS No 16635-95-3
English Name 1,2-Diphenylethylenediamine
Molecular Formula C28H32N4
Molecular Weight 424.58 g/mol
SMILES N[C@@H]([C@@H](c1ccccc1)N)c1ccccc1.N[C@H]([C@H](c1ccccc1)N)c1ccccc1
InChIKey AWEVAOPIZHFUIV-ATLWNKLRSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What are the main uses of 1,2-Diphenylethylenediamine (CAS: 16635-95-3)?

1,2-Diphenylethylenediamine (CAS: 16635-95-3) is primarily used as a chemical intermediate in the sy...

Compound Q&A

Is 1,2-Diphenylethylenediamine (CAS: 16635-95-3) safe?

1,2-Diphenylethylenediamine (CAS: 16635-95-3) is generally considered safe when handled properly. Ho...

Compound Q&A

How should 1,2-Diphenylethylenediamine (CAS: 16635-95-3) be stored?

1,2-Diphenylethylenediamine (CAS: 16635-95-3) should be stored in a cool, dry place away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...