Compound Q&A

What is Hoffer's Chlorosugar (CAS: 4330-21-6)?

Answer

Hoffer's Chlorosugar (~90%)
Hoffer's Chlorosugar (CAS: 4330-21-6) is a chlorosugar derivative primarily used in pharmaceutical applications, synthesized from glucose. It is known for its unique chemical properties and is used in the synthesis of certain drugs and intermediates.

About

CAS No 4330-21-6
English Name Hoffer's Chlorosugar (~90%)
Molecular Formula C21H21ClO5
Molecular Weight 388.85 g/mol
SMILES CC1=CC=C(C=C1)C(=O)OCC2C(CC(O2)Cl)OC(=O)C3=CC=C(C=C3)C
InChIKey FJHSYOMVMMNQJQ-OTWHNJEPSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What are the main uses of Hoffer's Chlorosugar (CAS: 4330-21-6)?

Hoffer's Chlorosugar (CAS: 4330-21-6) is mainly used in the pharmaceutical industry for the synthesi...

Compound Q&A

Is Hoffer's Chlorosugar (CAS: 4330-21-6) safe?

Hoffer's Chlorosugar (CAS: 4330-21-6) is generally considered safe when handled properly. However, i...

Compound Q&A

How should Hoffer's Chlorosugar (CAS: 4330-21-6) be stored?

Hoffer's Chlorosugar (CAS: 4330-21-6) should be stored in a cool, dry place away from direct sunligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...