Compound Q&A

What are the main uses of 6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0)?

Answer

6-Amino-1-naphthalenesulfonic acid
6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0) is primarily used as a pH indicator in analytical chemistry. It is also employed in water treatment for its sulfonic acid group, which can be used in various industrial applications. Additionally, it is used in research for its color-changing properties and as a reagent in biochemistry and organic synthesis.

About

CAS No 81-05-0
English Name 6-Amino-1-naphthalenesulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C=CC(=C2)N)C(=C1)S(=O)(=O)O
InChIKey YUNBHHWDQDGWHC-UHFFFAOYSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What is 6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0)?

6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0) is an organic compound with the formula C10H7NO3S....

Compound Q&A

Is 6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0) safe?

6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0) is generally considered safe for use in analytical...

Compound Q&A

How should 6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0) be stored?

6-Amino-1-naphthalenesulfonic acid (CAS: 81-05-0) should be stored in a cool, dry place, away from d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...