Compound Q&A

What is 5-Nitro-2(1H)-pyridinone (CAS: 5418-51-9)?

Answer

5-Nitro-2(1H)-pyridinone
5-Nitro-2(1H)-pyridinone is a heterocyclic compound with the CAS number 5418-51-9. It has the chemical formula C6H5N2O3 and is characterized by its yellow crystalline form. This compound possesses properties such as solubility in water and organic solvents, and it is often used in various applications due to its reactivity and stability.

About

CAS No 5418-51-9
English Name 5-Nitro-2(1H)-pyridinone
Molecular Formula C5H4N2O3
Molecular Weight 140.1 g/mol
SMILES C1=CC(=O)NC=C1[N+](=O)[O-]
InChIKey XKWSQIMYNVLGBO-UHFFFAOYSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What are the main uses of 5-Nitro-2(1H)-pyridinone (CAS: 5418-51-9)?

5-Nitro-2(1H)-pyridinone is primarily used in pharmaceuticals for synthesizing other compounds, and ...

Compound Q&A

Is 5-Nitro-2(1H)-pyridinone (CAS: 5418-51-9) safe?

5-Nitro-2(1H)-pyridinone is generally considered safe under normal handling conditions, but appropri...

Compound Q&A

How should 5-Nitro-2(1H)-pyridinone (CAS: 5418-51-9) be stored?

5-Nitro-2(1H)-pyridinone should be stored in a cool, dry place, away from direct sunlight and heat s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...