Compound Q&A

How should [2-(Methylamino)-3-pyridinyl]methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 1180002-01-0) be stored?

Answer

[2-(Methylamino)-3-pyridinyl]methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate
This compound should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and light from affecting its stability. Avoid storing it near incompatible materials such as strong acids or bases.

About

English Name [2-(Methylamino)-3-pyridinyl]methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate
Molecular Formula C15H23N3O4
Molecular Weight 309.37 g/mol
SMILES CC(C)(C)OC(=O)N(C)CC(=O)OCc1cccnc1NC
InChIKey SREJHHORJXVQGX-UHFFFAOYSA-N
Last Updated: 2025-09-15 19:28

Related Q&A

Compound Q&A

What is [2-(Methylamino)-3-pyridinyl]methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 1180002-01-0)?

This compound is a complex organic molecule used primarily in pharmaceutical research and developmen...

Compound Q&A

What are the main uses of [2-(Methylamino)-3-pyridinyl]methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 1180002-01-0)?

This compound is mainly used in pharmaceutical research and development for drug discovery and synth...

Compound Q&A

Is [2-(Methylamino)-3-pyridinyl]methyl N-methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}glycinate (CAS: 1180002-01-0) safe?

This compound is generally safe when handled with appropriate precautions. Proper personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...