Compound Q&A

Is Hederasaponin B (CAS: 36284-77-2) safe?

Answer

Hederasaponin B
Hederasaponin B is generally considered safe for topical use, but ingestion should be avoided. Users should follow recommended guidelines and consult a healthcare professional if any adverse reactions occur.

About

CAS No 36284-77-2
English Name Hederasaponin B
Molecular Formula C59H96O25
Molecular Weight 1205.39 g/mol
SMILES CC1OC(OC2C(O)C(O)C(OCC3OC(OC(=O)C45CCC(C)(C)CC4C4=CCC6C7(C)CCC(OC8OCC(O)C(O)C8OC8OC(C)C(O)C(O)C8O)C(C)(C)C7CCC6(C)C4(C)CC5)C(O)C(O)C3O)OC2CO)C(O)C(O)C1O
InChIKey NVSLBOBPSCMMSO-UHFFFAOYSA-N
Last Updated: 2025-09-15 09:35

Related Q&A

Compound Q&A

What is Hederasaponin B (CAS: 36284-77-2)?

Hederasaponin B is a triterpene saponin isolated from the genus Hedera, commonly found in plants of ...

Compound Q&A

What are the main uses of Hederasaponin B (CAS: 36284-77-2)?

Hederasaponin B is used in pharmaceutical and cosmetic industries for its potential anti-inflammator...

Compound Q&A

How should Hederasaponin B (CAS: 36284-77-2) be stored?

Store Hederasaponin B in a cool, dry place away from direct sunlight and heat. Maintain a temperatur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...