Compound Q&A

How should 4-(4-Nitrophenyl)-3-morpholinone (CAS: 446292-04-2) be stored?

Answer

4-(4-Nitrophenyl)-3-morpholinone
4-(4-Nitrophenyl)-3-morpholinone should be stored in a cool, dry place away from direct sunlight and sources of heat. It should be kept in a tightly sealed container to prevent moisture absorption. Proper storage conditions are crucial to maintain its stability and reactivity.

About

English Name 4-(4-Nitrophenyl)-3-morpholinone
Molecular Formula C10H10N2O4
Molecular Weight 222.2 g/mol
SMILES C1COCC(=O)N1C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey OWMGEFWSGOTGAU-UHFFFAOYSA-N
Last Updated: 2025-09-15 09:35

Related Q&A

Compound Q&A

What is 4-(4-Nitrophenyl)-3-morpholinone (CAS: 446292-04-2)?

4-(4-Nitrophenyl)-3-morpholinone is a chemical compound with the CAS number 446292-04-2. It is a whi...

Compound Q&A

What are the main uses of 4-(4-Nitrophenyl)-3-morpholinone (CAS: 446292-04-2)?

4-(4-Nitrophenyl)-3-morpholinone is primarily used in pharmaceuticals for its potential as a precurs...

Compound Q&A

Is 4-(4-Nitrophenyl)-3-morpholinone (CAS: 446292-04-2) safe?

4-(4-Nitrophenyl)-3-morpholinone is generally considered safe for laboratory use when appropriate sa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...