Compound Q&A

What is 2-Amino-4,5-dimethoxybenzoic acid (CAS: 5653-40-7)?

Answer

2-Amino-4,5-dimethoxybenzoic acid
2-Amino-4,5-dimethoxybenzoic acid, also known as 2-Amino-3,4-dimethoxybenzoic acid, is a white crystalline compound with the CAS number 5653-40-7. It has a molecular formula of C9H11NO4 and is commonly used in various industries including pharmaceuticals and research due to its unique chemical structure.

About

CAS No 5653-40-7
English Name 2-Amino-4,5-dimethoxybenzoic acid
Molecular Formula C9H11NO4
Molecular Weight 197.19 g/mol
SMILES COC1=C(C=C(C(=C1)C(=O)O)N)OC
InChIKey HJVAVGOPTDJYOJ-UHFFFAOYSA-N
Last Updated: 2025-09-15 09:35

Related Q&A

Compound Q&A

What are the main uses of 2-Amino-4,5-dimethoxybenzoic acid (CAS: 5653-40-7)?

2-Amino-4,5-dimethoxybenzoic acid is primarily used in pharmaceuticals for the synthesis of active p...

Compound Q&A

Is 2-Amino-4,5-dimethoxybenzoic acid (CAS: 5653-40-7) safe?

2-Amino-4,5-dimethoxybenzoic acid is considered safe when handled with appropriate precautions. Howe...

Compound Q&A

How should 2-Amino-4,5-dimethoxybenzoic acid (CAS: 5653-40-7) be stored?

2-Amino-4,5-dimethoxybenzoic acid should be stored in a cool, dry place, preferably in a desiccator ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...