Compound Q&A

What are the main uses of bis(adamantan-1-yl)(butyl)phosphane hydroiodide (CAS: 714951-87-8)?

Answer

bis(adamantan-1-yl)(butyl)phosphane hydroiodide
Bis(adamantan-1-yl)(butyl)phosphane hydroiodide is primarily used as a reagent in organic synthesis, particularly in palladium-catalyzed cross-coupling reactions. It is also used as a catalyst precursor in the production of various organic compounds and polymers. Additionally, it may be used in certain pharmaceutical and materials science applications.

About

English Name bis(adamantan-1-yl)(butyl)phosphane hydroiodide
Molecular Formula C24H40IP
Molecular Weight 486.46 g/mol
SMILES CCCCP(C12CC3CC(C1)CC(C3)C2)C45CC6CC(C4)CC(C6)C5.I
InChIKey IBXHWLZKSOGUFS-UHFFFAOYSA-N
Last Updated: 2025-09-15 09:35

Related Q&A

Compound Q&A

What is bis(adamantan-1-yl)(butyl)phosphane hydroiodide (CAS: 714951-87-8)?

Bis(adamantan-1-yl)(butyl)phosphane hydroiodide is a chemical compound with the CAS number 714951-87...

Compound Q&A

Is bis(adamantan-1-yl)(butyl)phosphane hydroiodide (CAS: 714951-87-8) safe?

Bis(adamantan-1-yl)(butyl)phosphane hydroiodide is generally considered safe when handled with appro...

Compound Q&A

How should bis(adamantan-1-yl)(butyl)phosphane hydroiodide (CAS: 714951-87-8) be stored?

Bis(adamantan-1-yl)(butyl)phosphane hydroiodide should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...