Compound Q&A

What is BAPTA (CAS: 85233-19-8)?

Answer

BAPTA (1,2-bis(o-Aminophenoxy)ethane-N,N,N',N'-tetra-Acetic Acid)
BAPTA, or 1,2-bis(o-Aminophenoxy)ethane-N,N,N',N'-tetra-Acetic Acid, is a chelating agent used in various applications due to its ability to bind metal ions effectively. It has the chemical formula C12H17N2O8 and is known for its high affinity and specificity for certain metal ions.

About

CAS No 85233-19-8
English Name BAPTA (1,2-bis(o-Aminophenoxy)ethane-N,N,N',N'-tetra-Acetic Acid)
Molecular Formula C22H24N2O10
Molecular Weight 476.44 g/mol
SMILES c1ccc(c(c1)N(CC(=O)O)CC(=O)O)OCCOc2ccccc2N(CC(=O)O)CC(=O)O
InChIKey FTEDXVNDVHYDQW-UHFFFAOYSA-N
Last Updated: 2025-09-15 09:35

Related Q&A

Compound Q&A

What are the main uses of BAPTA (CAS: 85233-19-8)?

BAPTA is primarily used in research for its ability to chelate metal ions, stabilizing proteins and ...

Compound Q&A

Is BAPTA (CAS: 85233-19-8) safe?

BAPTA is generally considered safe when used according to recommended guidelines. However, it is imp...

Compound Q&A

How should BAPTA (CAS: 85233-19-8) be stored?

BAPTA should be stored in a cool, dry place away from direct sunlight and heat sources to prevent de...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...