Compound Q&A

How should Phenyl(sulfo)acetic acid (CAS: 41360-32-1) be stored?

Answer

Phenyl(sulfo)acetic acid
Phenyl(sulfo)acetic acid (CAS: 41360-32-1) should be stored in a cool, dry place away from direct sunlight and heat sources. Store it in a sealed container to prevent moisture and contamination. The container should be tightly sealed to maintain the purity of the compound.

About

CAS No 41360-32-1
English Name Phenyl(sulfo)acetic acid
Molecular Formula C8H8O5S
Molecular Weight 216.21 g/mol
SMILES C1=CC=C(C=C1)C(C(=O)O)S(=O)(=O)O
InChIKey USNMCXDGQQVYSW-UHFFFAOYSA-N
Last Updated: 2025-09-15 09:35

Related Q&A

Compound Q&A

What is Phenyl(sulfo)acetic acid (CAS: 41360-32-1)?

Phenyl(sulfo)acetic acid (CAS: 41360-32-1) is a chemical compound with the molecular formula C8H7NO3...

Compound Q&A

What are the main uses of Phenyl(sulfo)acetic acid (CAS: 41360-32-1)?

Phenyl(sulfo)acetic acid (CAS: 41360-32-1) finds applications in pharmaceuticals for the synthesis o...

Compound Q&A

Is Phenyl(sulfo)acetic acid (CAS: 41360-32-1) safe?

Phenyl(sulfo)acetic acid (CAS: 41360-32-1) is generally safe when handled with appropriate precautio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...