Compound Q&A

How is 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3) typically synthesized?

Answer

3-Amino-5-chloro-2-hydroxybenzenesulfonic acid
3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3) can be synthesized through a multi-step process. Common methods include chlorination of 2-hydroxy-3-aminobenzenesulfonic acid followed by sulfonation. This process typically involves the use of sulfuric acid as a catalyst and requires careful temperature and pH control to achieve high yields.

About

CAS No 88-23-3
English Name 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid
Molecular Formula C6H6ClNO4S
Molecular Weight 223.64 g/mol
SMILES C1=C(C=C(C(=C1N)O)S(=O)(=O)O)Cl
InChIKey YCTAOQGPWNTYJE-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3)?

3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3) is a white to off-white crystalline po...

Compound Q&A

What industries use 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3)?

3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3)?

When handling 3-Amino-5-chloro-2-hydroxybenzenesulfonic acid (CAS: 88-23-3), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...