Compound Q&A

How is 1,2-Bis(4-methoxyphenyl)-1,2-ethanedione (CAS: 1226-42-2) typically synthesized?

Answer

1,2-Bis(4-methoxyphenyl)-1,2-ethanedione
1,2-Bis(4-methoxyphenyl)-1,2-ethanedione can be synthesized through the condensation of 4-methoxybenzaldehyde with acetone using an acid catalyst such as sulfuric acid. The reaction is typically performed in a solvent like methanol at elevated temperatures. The yield is around 90%, and the product is isolated by recrystallization from an appropriate solvent.

About

CAS No 1226-42-2
English Name 1,2-Bis(4-methoxyphenyl)-1,2-ethanedione
Molecular Formula C16H14O4
Molecular Weight 270.28 g/mol
SMILES COc1ccc(cc1)C(=O)C(=O)c2ccc(OC)cc2
InChIKey YNANGXWUZWWFKX-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Bis(4-methoxyphenyl)-1,2-ethanedione (CAS: 1226-42-2)?

1,2-Bis(4-methoxyphenyl)-1,2-ethanedione (CAS: 1226-42-2) is a crystalline solid with a molecular we...

Compound Q&A

What industries use 1,2-Bis(4-methoxyphenyl)-1,2-ethanedione (CAS: 1226-42-2)?

1,2-Bis(4-methoxyphenyl)-1,2-ethanedione (CAS: 1226-42-2) is used in various industries. It is parti...

Compound Q&A

What precautions should be taken when handling 1,2-Bis(4-methoxyphenyl)-1,2-ethanedione (CAS: 1226-42-2)?

When handling 1,2-Bis(4-methoxyphenyl)-1,2-ethanedione (CAS: 1226-42-2), it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...