Compound Q&A

What are the physical and chemical properties of Benzo[e]acephenanthrylene (CAS: 205-99-2)?

Answer

Benzo[e]acephenanthrylene
Benzo[e]acephenanthrylene is a solid compound with a crystalline form. Its molecular weight is approximately 318.23 g/mol. It has low solubility in water but is more soluble in organic solvents like chloroform and acetone. It is relatively stable under normal conditions but can react with strong oxidizing agents. This compound is typically used in research contexts due to its unique electronic and structural properties.

About

CAS No 205-99-2
English Name Benzo[e]acephenanthrylene
Molecular Formula C20H12
Molecular Weight 252.32 g/mol
SMILES C1=CC=C2C3=C4C(=CC=C3)C5=CC=CC=C5C4=CC2=C1
InChIKey FTOVXSOBNPWTSH-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Benzo[e]acephenanthrylene (CAS: 205-99-2) typically synthesized?

Benzo[e]acephenanthrylene can be synthesized through a series of reactions including Friedel-Crafts ...

Compound Q&A

What industries use Benzo[e]acephenanthrylene (CAS: 205-99-2)?

Benzo[e]acephenanthrylene finds application in the pharmaceutical industry for synthesizing certain ...

Compound Q&A

What precautions should be taken when handling Benzo[e]acephenanthrylene (CAS: 205-99-2)?

When handling Benzo[e]acephenanthrylene, it is crucial to use appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...