Compound Q&A

What precautions should be taken when handling triphosphooxyalumane (CAS: 13776-88-0)?

Answer

triphosphooxyalumane
When handling triphosphooxyalumane (CAS: 13776-88-0), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be addressed using appropriate absorbents, and the material safety data sheet (MSDS) should be referenced for detailed emergency procedures and handling instructions.

About

CAS No 13776-88-0
English Name triphosphooxyalumane
Molecular Formula AlO9P3
Molecular Weight 263.9 g/mol
SMILES O=P(=O)O[Al](OP(=O)=O)OP(=O)=O
InChIKey DHAHRLDIUIPTCJ-UHFFFAOYSA-K
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of triphosphooxyalumane (CAS: 13776-88-0)?

Triphosphooxyalumane (CAS: 13776-88-0) is a crystalline solid with a high molecular weight and low s...

Compound Q&A

How is triphosphooxyalumane (CAS: 13776-88-0) typically synthesized?

Triphosphooxyalumane is typically synthesized through the reaction of aluminum oxide with phosphorus...

Compound Q&A

What industries use triphosphooxyalumane (CAS: 13776-88-0)?

Triphosphooxyalumane (CAS: 13776-88-0) finds applications in the pharmaceutical industry for the syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...