Compound Q&A

What are the physical and chemical properties of (1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride (CAS: 521284-22-0)?

Answer

(1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride (1:1)
The compound (1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride is a white crystalline solid with a molecular weight of approximately 343.8 g/mol. It has a pKa of about 5.5 and a solubility of 10 mg/mL in water. The compound is moderately reactive and can undergo hydrolysis under acidic conditions. It is soluble in common organic solvents like ethanol and acetone.

About

English Name (1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride (1:1)
Molecular Formula C16H21ClN2O
Molecular Weight 292.81 g/mol
SMILES Nc1ccc(cc1)CCNC[C@@H](c1ccccc1)O.Cl
InChIKey QILVTBCJVNFIDP-NTISSMGPSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is (1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride (CAS: 521284-22-0) typically synthesized?

(1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride can be synthesized via a multi-...

Compound Q&A

What industries use (1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride (CAS: 521284-22-0)?

(1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling (1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride (CAS: 521284-22-0)?

Proper handling of (1R)-2-{[2-(4-Aminophenyl)ethyl]amino}-1-phenylethanol hydrochloride requires the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...