Compound Q&A

What are the physical and chemical properties of 3-[(2-Cyano-3,3-diphenylacryloyl)oxy]-2,2-bis{[(2-cyano-3,3-diphenylacryloyl)oxy]methyl}propyl 2-cyano-3,3-diphenylacrylate (CAS: 178671-58-4)?

Answer

3-[(2-Cyano-3,3-diphenylacryloyl)oxy]-2,2-bis{[(2-cyano-3,3-diphenylacryloyl)oxy]methyl}propyl 2-cyano-3,3-diphenylacrylate
The compound is a crystalline solid with a high molecular weight. It is poorly soluble in water but soluble in organic solvents like dichloromethane and acetonitrile. Chemically, it is highly reactive due to its cyano and acrylate functionalities, making it suitable for various chemical reactions. Its reactivity and physical properties make it useful in polymer synthesis and functional materials.

About

English Name 3-[(2-Cyano-3,3-diphenylacryloyl)oxy]-2,2-bis{[(2-cyano-3,3-diphenylacryloyl)oxy]methyl}propyl 2-cyano-3,3-diphenylacrylate
Molecular Formula C69H48N4O8
Molecular Weight 17.03 g/mol
SMILES C1=CC=C(C=C1)C(=C(C#N)C(=O)OCC(COC(=O)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C#N)(COC(=O)C(=C(C4=CC=CC=C4)C5=CC=CC=C5)C#N)COC(=O)C(=C(C6=CC=CC=C6)C7=CC=CC=C7)C#N)C8=CC=CC=C8
InChIKey CVSXFBFIOUYODT-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is 3-[(2-Cyano-3,3-diphenylacryloyl)oxy]-2,2-bis{[(2-cyano-3,3-diphenylacryloyl)oxy]methyl}propyl 2-cyano-3,3-diphenylacrylate (CAS: 178671-58-4) typically synthesized?

This compound is synthesized through a multi-step process involving acrylate esterification and coup...

Compound Q&A

What industries use 3-[(2-Cyano-3,3-diphenylacryloyl)oxy]-2,2-bis{[(2-cyano-3,3-diphenylacryloyl)oxy]methyl}propyl 2-cyano-3,3-diphenylacrylate (CAS: 178671-58-4)?

This compound is primarily used in the pharmaceutical industry for drug development and in polymer s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...