Compound Q&A

What are the physical and chemical properties of Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate) (CAS: 5945-33-5)?

Answer

Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate)
Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate) has a crystalline form and a high molecular weight. It is poorly soluble in water but soluble in organic solvents. This compound exhibits low reactivity under normal conditions, making it stable for many applications. It is commonly used in research and industrial settings where its chemical properties offer unique functionalities.

About

CAS No 5945-33-5
English Name Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate)
Molecular Formula C39H34O8P2
Molecular Weight 692.64 g/mol
SMILES CC(C)(C1=CC=C(OP(OC2=CC=CC=C2)(OC3=CC=CC=C3)=O)C=C1)C4=CC=C(OP(OC5=CC=CC=C5)(OC6=CC=CC=C6)=O)C=C4
InChIKey BQPNUOYXSVUVMY-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate) (CAS: 5945-33-5) typically synthesized?

Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate) is synthesized through the condensation o...

Compound Q&A

What industries use Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate) (CAS: 5945-33-5)?

Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate) is used in a variety of industries, inclu...

Compound Q&A

What precautions should be taken when handling Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate) (CAS: 5945-33-5)?

When handling Tetraphenyl 2,2-propanediyldi-4,1-phenylene bis(phosphate), use proper personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...