Compound Q&A

How is Sinigrin (CAS: 3952-98-5) typically synthesized?

Answer

Sinigrin
Sinigrin can be synthesized through the condensation of sinapaldehyde and isothiocyanate in the presence of a base such as sodium hydroxide. The synthesis yields sinigrin with a high degree of purity. The process is selective and achieves a yield of about 75-85%. This method is widely used in the production of sinigrin for various applications.

About

CAS No 3952-98-5
English Name Sinigrin
Molecular Formula C10H16KNO9S2
Molecular Weight 398.48 g/mol
SMILES C=CCC(=NOS(=O)(=O)[O-])SC1C(C(C(C(O1)CO)O)O)O.[K+]
InChIKey BSNLGANCHAHVBW-JMJVLJGISA-L
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sinigrin (CAS: 3952-98-5)?

Sinigrin is a crystalline compound with a molecular weight of approximately 322.21 g/mol. It is slig...

Compound Q&A

What industries use Sinigrin (CAS: 3952-98-5)?

Sinigrin (CAS: 3952-98-5) is used in the pharmaceutical industry for its anti-inflammatory and antim...

Compound Q&A

What precautions should be taken when handling Sinigrin (CAS: 3952-98-5)?

When handling sinigrin, it is essential to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...