Compound Q&A

What are the physical and chemical properties of (3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3)?

Answer

(3,4-Dihydroxyphenyl)(phenyl)methanone
(3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3) is a colorless or white crystalline solid with a molecular weight of approximately 244.22 g/mol. It is slightly soluble in water and has a melting point of around 148-150°C. It is reactive towards bases and can undergo esterification and condensation reactions. It is often used in pharmaceutical and chemical synthesis due to its structural complexity and reactivity.

About

CAS No 10425-11-3
English Name (3,4-Dihydroxyphenyl)(phenyl)methanone
Molecular Formula C13H10O3
Molecular Weight 214.22 g/mol
SMILES C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)O)O
InChIKey ARWCZKJISXFBGI-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is (3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3) typically synthesized?

(3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3) is typically synthesized via the condensati...

Compound Q&A

What industries use (3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3)?

(3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3) is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling (3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3)?

When handling (3,4-Dihydroxyphenyl)(phenyl)methanone (CAS: 10425-11-3), it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...