Compound Q&A

What are the physical and chemical properties of Benzo[cd]indol-2(1H)-one (CAS: 130-00-7)?

Answer

Benzo[cd]indol-2(1H)-one
Benzo[cd]indol-2(1H)-one (CAS: 130-00-7) is a crystalline solid with a molecular weight of approximately 147.14 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetonitrile. Chemically, it is moderately reactive and can undergo various transformations such as oxidation and reduction. It is often used in medicinal chemistry and organic synthesis due to its functional groups.

About

CAS No 130-00-7
English Name Benzo[cd]indol-2(1H)-one
Molecular Formula C11H7NO
Molecular Weight 169.18 g/mol
SMILES C1=CC2=C3C(=C1)C(=O)NC3=CC=C2
InChIKey GPYLCFQEKPUWLD-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

How is Benzo[cd]indol-2(1H)-one (CAS: 130-00-7) typically synthesized?

Benzo[cd]indol-2(1H)-one (CAS: 130-00-7) can be synthesized through the condensation of a suitable a...

Compound Q&A

What industries use Benzo[cd]indol-2(1H)-one (CAS: 130-00-7)?

Benzo[cd]indol-2(1H)-one (CAS: 130-00-7) finds applications in various industries. It is primarily u...

Compound Q&A

What precautions should be taken when handling Benzo[cd]indol-2(1H)-one (CAS: 130-00-7)?

When handling Benzo[cd]indol-2(1H)-one (CAS: 130-00-7), it is important to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...