Compound Q&A

How is Rifamycin O (CAS: 14487-05-9) typically synthesized?

Answer

Rifamycin O
Rifamycin O is typically synthesized through a multi-step process involving fermentation and chemical modification. The fermentation step involves the production of the natural precursor, followed by chemical modifications such as acetylation and demethylation to yield Rifamycin O. Common catalysts and reagents include acetic anhydride and sodium methoxide. The overall yield is around 30-40%, with high selectivity for the desired product.

About

CAS No 14487-05-9
English Name Rifamycin O
Molecular Formula C39H47NO14
Molecular Weight 753.8 g/mol
SMILES CC1C=CC=C(C(=O)NC2=CC3(C4=C(C2=O)C(=C(C5=C4C(=O)C(O5)(OC=CC(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)OCC(=O)O3)C
InChIKey RAFHKEAPVIWLJC-KQOHHTLASA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Rifamycin O (CAS: 14487-05-9)?

Rifamycin O, with CAS number 14487-05-9, is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Rifamycin O (CAS: 14487-05-9)?

Rifamycin O is primarily used in the pharmaceutical industry for its antimicrobial properties, parti...

Compound Q&A

What precautions should be taken when handling Rifamycin O (CAS: 14487-05-9)?

When handling Rifamycin O, it is important to wear appropriate personal protective equipment (PPE), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...