Compound Q&A

How is Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4) typically synthesized?

Answer

Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate}
Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4) is synthesized through a multi-step process involving the reaction of 4-nitrobenzyl chloride with 3-hydroxy-2-oxopropionic acid. The synthesis typically requires the use of magnesium metal as a reducing agent and is carried out under anhydrous conditions to ensure high purity and yield.

About

CAS No 83972-01-4
English Name Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate}
Molecular Formula C20H16MgN2O12
Molecular Weight 500.7 g/mol
SMILES C1=CC(=CC=C1COC(=O)CC(=O)[O-])[N+](=O)[O-].C1=CC(=CC=C1COC(=O)CC(=O)[O-])[N+](=O)[O-].[Mg+2]
InChIKey WAFDWKYNSTVECG-UHFFFAOYSA-L
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4)?

Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4) is a white crystalline solid...

Compound Q&A

What industries use Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4)?

Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4) finds applications in pharma...

Compound Q&A

What precautions should be taken when handling Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4)?

When handling Magnesium bis{3-[(4-nitrobenzyl)oxy]-3-oxopropanoate} (CAS: 83972-01-4), it is importa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...