Compound Q&A

How is 9H,9'H-3,3'-Bicarbazole (CAS: 1984-49-2) typically synthesized?

Answer

9H,9'H-3,3'-Bicarbazole
9H,9'H-3,3'-Bicarbazole is typically synthesized via a multistep reaction involving the condensation of 3-carbethoxy-3'-(carbethoxy carbonyl)carbazole with a suitable reagent. The synthesis often requires the use of a base such as sodium hydride, and a solvent like THF. Yields and selectivity can be enhanced by optimizing the reaction conditions.

About

CAS No 1984-49-2
English Name 9H,9'H-3,3'-Bicarbazole
Molecular Formula C24H16N2
Molecular Weight 332.41 g/mol
SMILES C1=CC=C2C(=C1)C3=C(N2)C=CC(=C3)C4=CC5=C(C=C4)NC6=CC=CC=C65
InChIKey PUMOFXXLEABBTC-UHFFFAOYSA-N
Last Updated: 2025-09-13 09:53

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H,9'H-3,3'-Bicarbazole (CAS: 1984-49-2)?

9H,9'H-3,3'-Bicarbazole (CAS: 1984-49-2) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use 9H,9'H-3,3'-Bicarbazole (CAS: 1984-49-2)?

9H,9'H-3,3'-Bicarbazole (CAS: 1984-49-2) is used in various industries including pharmaceuticals for...

Compound Q&A

What precautions should be taken when handling 9H,9'H-3,3'-Bicarbazole (CAS: 1984-49-2)?

When handling 9H,9'H-3,3'-Bicarbazole (CAS: 1984-49-2), it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...