Compound Q&A

What are the main uses of N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride (CAS: 25606-41-1)?

Answer

N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride
N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride is primarily used in the pharmaceutical industry for the synthesis of other compounds and in the research field for developing new drug candidates. It is also utilized in the chemical industry as a precursor in polymer synthesis and in the food industry for certain applications.

About

CAS No 25606-41-1
English Name N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride
Molecular Formula C9H21ClN2O2
Molecular Weight 224.73 g/mol
SMILES CCCOC(=O)NCCC[NH+](C)C.[Cl-]
InChIKey MKIMSXGUTQTKJU-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride (CAS: 25606-41-1)?

N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride is a chemical compound with the CAS...

Compound Q&A

Is N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride (CAS: 25606-41-1) safe?

N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride is generally considered safe when h...

Compound Q&A

How should N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride (CAS: 25606-41-1) be stored?

N,N-Dimethyl-3-[(propoxycarbonyl)amino]-1-propanaminium chloride should be stored in a cool, dry pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...