Compound Q&A

How should NADP sodium salt (CAS: 1184-16-3) be stored?

Answer

NADP sodium salt
NADP sodium salt should be stored in a cool, dry place away from direct sunlight and moisture. It is best kept in a tightly sealed container to prevent degradation. It should be stored at a temperature between 15-25°C (59-77°F). Avoid exposure to heat, which can lead to loss of potency and stability.

About

CAS No 1184-16-3
English Name NADP sodium salt
Molecular Formula C21H27N7NaO17P3
Molecular Weight 765.4 g/mol
SMILES C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)OP(=O)(O)O)O)O)O)C(=O)N.[Na+]
InChIKey JNUMDLCHLVUHFS-QYZPTAICSA-M
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is NADP sodium salt (CAS: 1184-16-3)?

NADP sodium salt, also known as nicotinamide adenine dinucleotide phosphate sodium salt, is a key co...

Compound Q&A

What are the main uses of NADP sodium salt (CAS: 1184-16-3)?

NADP sodium salt is primarily used as a coenzyme in biological research and pharmaceutical applicati...

Compound Q&A

Is NADP sodium salt (CAS: 1184-16-3) safe?

NADP sodium salt is generally considered safe when used as directed. However, it can cause skin irri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...