Compound Q&A

What is 4,4'-Oxydibenzenesulfonyl chloride (CAS: 121-63-1)?

Answer

4,4'-Oxydibenzenesulfonyl chloride
4,4'-Oxydibenzenesulfonyl chloride, also known as 4,4'-oxydibenzenesulfonyl chloride, is a chemical compound with the CAS number 121-63-1. It is a white or off-white crystalline solid. This compound is used in various industries including pharmaceuticals, research, and chemical synthesis due to its reactive properties.

About

CAS No 121-63-1
English Name 4,4'-Oxydibenzenesulfonyl chloride
Molecular Formula C12H8Cl2O5S2
Molecular Weight 367.23 g/mol
SMILES C1=CC(=CC=C1OC2=CC=C(C=C2)S(=O)(=O)Cl)S(=O)(=O)Cl
InChIKey HJKXLQIPODSWMB-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What are the main uses of 4,4'-Oxydibenzenesulfonyl chloride (CAS: 121-63-1)?

4,4'-Oxydibenzenesulfonyl chloride is primarily used in the synthesis of other chemicals and pharmac...

Compound Q&A

Is 4,4'-Oxydibenzenesulfonyl chloride (CAS: 121-63-1) safe?

4,4'-Oxydibenzenesulfonyl chloride can be safe when handled with appropriate precautions. It is corr...

Compound Q&A

How should 4,4'-Oxydibenzenesulfonyl chloride (CAS: 121-63-1) be stored?

4,4'-Oxydibenzenesulfonyl chloride should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...