Compound Q&A

What is Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7)?

Answer

Cyclohexyl(hydroxy)phenylacetic acid
Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7) is a chemical compound with the molecular formula C12H14O3. It is an aromatic acid derivative with a cyclohexyl group attached to a phenylacetic acid moiety. This compound has a distinctive structure that makes it useful in various applications due to its chemical and physical properties.

About

CAS No 4335-77-7
English Name Cyclohexyl(hydroxy)phenylacetic acid
Molecular Formula C14H18O3
Molecular Weight 234.29 g/mol
SMILES C1CCC(CC1)C(C2=CC=CC=C2)(C(=O)O)O
InChIKey YTRNSQPXEDGWMR-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What are the main uses of Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7)?

Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7) is primarily used in the pharmaceutical and re...

Compound Q&A

Is Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7) safe?

Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7) is generally considered safe for its intended ...

Compound Q&A

How should Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7) be stored?

Cyclohexyl(hydroxy)phenylacetic acid (CAS: 4335-77-7) should be stored in a cool, dry place away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...