Compound Q&A

What are the main uses of 7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate (CAS: 125536-25-6)?

Answer

7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate
The main uses of 7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate include pharmaceuticals as an intermediate in the synthesis of other compounds, research applications, and potential use in organic synthesis.

About

English Name 7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate
Molecular Formula C17H15ClO7
Molecular Weight 366.75 g/mol
SMILES Cc1c(cc2c(c1OC)ccc([o+]2)c3ccccc3)O.[O-]Cl(=O)(=O)=O
InChIKey KRTYZFUODYMZPG-UHFFFAOYSA-N
Last Updated: 2025-09-12 19:41

Related Q&A

Compound Q&A

What is 7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate (CAS: 125536-25-6)?

7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate is a chromone derivative with the chemic...

Compound Q&A

Is 7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate (CAS: 125536-25-6) safe?

7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate is generally considered safe when handle...

Compound Q&A

How should 7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate (CAS: 125536-25-6) be stored?

7-Hydroxy-5-methoxy-6-methyl-2-phenylchromenium perchlorate should be stored in a cool, dry place aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...